C6H8F4O — CID 54495820
1,1,3,3-tetrafluoro-2-prop-2-enoxypropane (PubChem CID 54495820) has the molecular formula C6H8F4O and a molecular weight of 172.12 g/mol. Its IUPAC name is 1,1,3,3-tetrafluoro-2-prop-2-enoxypropane.
| Compound Name | 1,1,3,3-tetrafluoro-2-prop-2-enoxypropane |
|---|---|
| PubChem CID | 54495820 |
| Molecular Formula | C6H8F4O |
| Molecular Weight | 172.12 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | 1,1,3,3-tetrafluoro-2-prop-2-enoxypropane |
| SMILES | C=CCOC(C(F)F)C(F)F |
| InChI | InChI=1S/C6H8F4O/c1-2-3-11-4(5(7)8)6(9)10/h2,4-6H,1,3H2 |
| InChIKey | XYZYUYCDMFUMLW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.12 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|