C10H12F6O — CID 57173601
5,5,5-trifluoro-3-(5,5,5-trifluoropent-1-en-3-yloxy)pent-1-ene (PubChem CID 57173601) has the molecular formula C10H12F6O and a molecular weight of 262.19 g/mol. Its IUPAC name is 5,5,5-trifluoro-3-(5,5,5-trifluoropent-1-en-3-yloxy)pent-1-ene.
| Compound Name | 5,5,5-trifluoro-3-(5,5,5-trifluoropent-1-en-3-yloxy)pent-1-ene |
|---|---|
| PubChem CID | 57173601 |
| Molecular Formula | C10H12F6O |
| Molecular Weight | 262.19 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 5,5,5-trifluoro-3-(5,5,5-trifluoropent-1-en-3-yloxy)pent-1-ene |
| SMILES | C=CC(CC(F)(F)F)OC(C=C)CC(F)(F)F |
| InChI | InChI=1S/C10H12F6O/c1-3-7(5-9(11,12)13)17-8(4-2)6-10(14,15)16/h3-4,7-8H,1-2,5-6H2 |
| InChIKey | FOPMWKBUKSAKOU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.19 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|