C12H8F16O3 — CID 59628136
1,1,1,2,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-3-(1,1,1-trifluoro-3-prop-2-enoxypropan-2-yl)oxypropane (PubChem CID 59628136) has the molecular formula C12H8F16O3 and a molecular weight of 504.16 g/mol. Its IUPAC name is 1,1,1,2,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-3-(1,1,1-trifluoro-3-prop-2-enoxypropan-2-yl)oxypropane.
| Compound Name | 1,1,1,2,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-3-(1,1,1-trifluoro-3-prop-2-enoxypropan-2-yl)oxypropane |
|---|---|
| PubChem CID | 59628136 |
| Molecular Formula | C12H8F16O3 |
| Molecular Weight | 504.16 g/mol |
| Exact Mass | 504.02 |
| IUPAC Name | 1,1,1,2,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-3-(1,1,1-trifluoro-3-prop-2-enoxypropan-2-yl)oxypropane |
| SMILES | C=CCOCC(OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H8F16O3/c1-2-3-29-4-5(6(13,14)15)30-12(27,28)8(18,10(22,23)24)31-11(25,26)7(16,17)9(19,20)21/h2,5H,1,3-4H2 |
| InChIKey | LUGODBTZUOVJKL-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.16 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|