C12H5F19O3 — CID 14766787
1,1,1,2,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-3-prop-2-enoxypropane (PubChem CID 14766787) has the molecular formula C12H5F19O3 and a molecular weight of 558.13 g/mol. Its IUPAC name is 1,1,1,2,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-3-prop-2-enoxypropane.
| Compound Name | 1,1,1,2,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-3-prop-2-enoxypropane |
|---|---|
| PubChem CID | 14766787 |
| Molecular Formula | C12H5F19O3 |
| Molecular Weight | 558.13 g/mol |
| Exact Mass | 557.99 |
| IUPAC Name | 1,1,1,2,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-3-prop-2-enoxypropane |
| SMILES | C=CCOC(F)(F)C(F)(OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H5F19O3/c1-2-3-32-11(28,29)5(15,8(20,21)22)34-12(30,31)6(16,9(23,24)25)33-10(26,27)4(13,14)7(17,18)19/h2H,1,3H2 |
| InChIKey | AUKMNNDRPRREAF-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.13 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|