C9H5F13O2 — CID 20802178
1,1,1,2,3,3-hexafluoro-3-(1,1,1,3-tetrafluoropropan-2-yloxy)-2-(1,1,2-trifluoroprop-2-enoxy)propane (PubChem CID 20802178) has the molecular formula C9H5F13O2 and a molecular weight of 392.11 g/mol. Its IUPAC name is 1,1,1,2,3,3-hexafluoro-3-(1,1,1,3-tetrafluoropropan-2-yloxy)-2-(1,1,2-trifluoroprop-2-enoxy)propane.
| Compound Name | 1,1,1,2,3,3-hexafluoro-3-(1,1,1,3-tetrafluoropropan-2-yloxy)-2-(1,1,2-trifluoroprop-2-enoxy)propane |
|---|---|
| PubChem CID | 20802178 |
| Molecular Formula | C9H5F13O2 |
| Molecular Weight | 392.11 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | 1,1,1,2,3,3-hexafluoro-3-(1,1,1,3-tetrafluoropropan-2-yloxy)-2-(1,1,2-trifluoroprop-2-enoxy)propane |
| SMILES | C=C(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(CF)C(F)(F)F |
| InChI | InChI=1S/C9H5F13O2/c1-3(11)6(15,16)24-7(17,8(18,19)20)9(21,22)23-4(2-10)5(12,13)14/h4H,1-2H2 |
| InChIKey | MTJYOMPBWMRYGO-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.11 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |