C8H2F14O — CID 131726624
2-[difluoro(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)methyl]-3,3,4,4,4-pentafluorobut-1-ene (PubChem CID 131726624) has the molecular formula C8H2F14O and a molecular weight of 380.08 g/mol. Its IUPAC name is 2-[difluoro(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)methyl]-3,3,4,4,4-pentafluorobut-1-ene.
| Compound Name | 2-[difluoro(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)methyl]-3,3,4,4,4-pentafluorobut-1-ene |
|---|---|
| PubChem CID | 131726624 |
| Molecular Formula | C8H2F14O |
| Molecular Weight | 380.08 g/mol |
| Exact Mass | 379.99 |
| IUPAC Name | 2-[difluoro(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)methyl]-3,3,4,4,4-pentafluorobut-1-ene |
| SMILES | C=C(C(F)(F)OC(F)(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H2F14O/c1-2(3(9,10)6(14,15)16)4(11,12)23-5(13,7(17,18)19)8(20,21)22/h1H2 |
| InChIKey | IDHLTPIHJAPEGJ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.08 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|