C8H2F11NO2 — CID 175706734
2,3,3,3-tetrafluoro-2-[1,2,2,2-tetrafluoro-1-(1,1,2-trifluoroprop-2-enoxy)ethoxy]propanenitrile (PubChem CID 175706734) has the molecular formula C8H2F11NO2 and a molecular weight of 353.09 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-2-[1,2,2,2-tetrafluoro-1-(1,1,2-trifluoroprop-2-enoxy)ethoxy]propanenitrile.
| Compound Name | 2,3,3,3-tetrafluoro-2-[1,2,2,2-tetrafluoro-1-(1,1,2-trifluoroprop-2-enoxy)ethoxy]propanenitrile |
|---|---|
| PubChem CID | 175706734 |
| Molecular Formula | C8H2F11NO2 |
| Molecular Weight | 353.09 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | 2,3,3,3-tetrafluoro-2-[1,2,2,2-tetrafluoro-1-(1,1,2-trifluoroprop-2-enoxy)ethoxy]propanenitrile |
| SMILES | C=C(F)C(F)(F)OC(F)(OC(F)(C#N)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H2F11NO2/c1-3(9)5(11,12)22-8(19,7(16,17)18)21-4(10,2-20)6(13,14)15/h1H2 |
| InChIKey | QTIMCCIXVLPWDG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.09 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|