C11H9F9O3 — CID 58864074
6-[difluoro(1,1,2-trifluoroprop-2-enoxy)methyl]-6,7,7,7-tetrafluoroheptane-2,4-dione (PubChem CID 58864074) has the molecular formula C11H9F9O3 and a molecular weight of 360.17 g/mol. Its IUPAC name is 6-[difluoro(1,1,2-trifluoroprop-2-enoxy)methyl]-6,7,7,7-tetrafluoroheptane-2,4-dione.
| Compound Name | 6-[difluoro(1,1,2-trifluoroprop-2-enoxy)methyl]-6,7,7,7-tetrafluoroheptane-2,4-dione |
|---|---|
| PubChem CID | 58864074 |
| Molecular Formula | C11H9F9O3 |
| Molecular Weight | 360.17 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 6-[difluoro(1,1,2-trifluoroprop-2-enoxy)methyl]-6,7,7,7-tetrafluoroheptane-2,4-dione |
| SMILES | C=C(F)C(F)(F)OC(F)(F)C(F)(CC(=O)CC(C)=O)C(F)(F)F |
| InChI | InChI=1S/C11H9F9O3/c1-5(21)3-7(22)4-8(13,10(16,17)18)11(19,20)23-9(14,15)6(2)12/h2-4H2,1H3 |
| InChIKey | JTMYBNIYTDMOCS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.17 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|