C6H4F6O2 — CID 19741880
1,1,2,2,3-pentafluoropropyl 2-fluoroprop-2-enoate (PubChem CID 19741880) has the molecular formula C6H4F6O2 and a molecular weight of 222.08 g/mol. Its IUPAC name is 1,1,2,2,3-pentafluoropropyl 2-fluoroprop-2-enoate.
| Compound Name | 1,1,2,2,3-pentafluoropropyl 2-fluoroprop-2-enoate |
|---|---|
| PubChem CID | 19741880 |
| Molecular Formula | C6H4F6O2 |
| Molecular Weight | 222.08 g/mol |
| Exact Mass | 222.01 |
| IUPAC Name | 1,1,2,2,3-pentafluoropropyl 2-fluoroprop-2-enoate |
| SMILES | C=C(F)C(=O)OC(F)(F)C(F)(F)CF |
| InChI | InChI=1S/C6H4F6O2/c1-3(8)4(13)14-6(11,12)5(9,10)2-7/h1-2H2 |
| InChIKey | KGUQYYGBGKTLHO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.08 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|