C18H8F14O4 — CID 88604704
[1,1,1,3,3,3-hexafluoro-2-[4-[1,1,1,3,3,3-hexafluoro-2-(2-fluoroprop-2-enoyloxy)propan-2-yl]phenyl]propan-2-yl] 2-fluoroprop-2-enoate (PubChem CID 88604704) has the molecular formula C18H8F14O4 and a molecular weight of 554.23 g/mol. Its IUPAC name is [1,1,1,3,3,3-hexafluoro-2-[4-[1,1,1,3,3,3-hexafluoro-2-(2-fluoroprop-2-enoyloxy)propan-2-yl]phenyl]propan-2-yl] 2-fluoroprop-2-enoate.
| Compound Name | [1,1,1,3,3,3-hexafluoro-2-[4-[1,1,1,3,3,3-hexafluoro-2-(2-fluoroprop-2-enoyloxy)propan-2-yl]phenyl]propan-2-yl] 2-fluoroprop-2-enoate |
|---|---|
| PubChem CID | 88604704 |
| Molecular Formula | C18H8F14O4 |
| Molecular Weight | 554.23 g/mol |
| Exact Mass | 554.02 |
| IUPAC Name | [1,1,1,3,3,3-hexafluoro-2-[4-[1,1,1,3,3,3-hexafluoro-2-(2-fluoroprop-2-enoyloxy)propan-2-yl]phenyl]propan-2-yl] 2-fluoroprop-2-enoate |
| SMILES | C=C(F)C(=O)OC(c1ccc(C(OC(=O)C(=C)F)(C(F)(F)F)C(F)(F)F)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H8F14O4/c1-7(19)11(33)35-13(15(21,22)23,16(24,25)26)9-3-5-10(6-4-9)14(17(27,28)29,18(30,31)32)36-12(34)8(2)20/h3-6H,1-2H2 |
| InChIKey | UJOPLTNZXHHJDX-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.23 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|