C21H17F9N2O2 — CID 90255197
[1,1,1,3,3,3-hexafluoro-2-[4-(4-piperazin-1-ylphenyl)phenyl]propan-2-yl] 2,2,2-trifluoroacetate (PubChem CID 90255197) has the molecular formula C21H17F9N2O2 and a molecular weight of 500.36 g/mol. Its IUPAC name is [1,1,1,3,3,3-hexafluoro-2-[4-(4-piperazin-1-ylphenyl)phenyl]propan-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [1,1,1,3,3,3-hexafluoro-2-[4-(4-piperazin-1-ylphenyl)phenyl]propan-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 90255197 |
| Molecular Formula | C21H17F9N2O2 |
| Molecular Weight | 500.36 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | [1,1,1,3,3,3-hexafluoro-2-[4-(4-piperazin-1-ylphenyl)phenyl]propan-2-yl] 2,2,2-trifluoroacetate |
| SMILES | O=C(OC(c1ccc(-c2ccc(N3CCNCC3)cc2)cc1)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C21H17F9N2O2/c22-19(23,24)17(33)34-18(20(25,26)27,21(28,29)30)15-5-1-13(2-6-15)14-3-7-16(8-4-14)32-11-9-31-10-12-32/h1-8,31H,9-12H2 |
| InChIKey | RJBUHMHKOPCRJW-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.36 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |