C22H21F9N2O3 — CID 46829283
1,1,1,3,3,3-hexafluoro-2-[4-[4-(piperazin-1-ylmethyl)phenyl]phenyl]propan-2-ol;2,2,2-trifluoroacetic acid (PubChem CID 46829283) has the molecular formula C22H21F9N2O3 and a molecular weight of 532.40 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[4-[4-(piperazin-1-ylmethyl)phenyl]phenyl]propan-2-ol;2,2,2-trifluoroacetic acid.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[4-[4-(piperazin-1-ylmethyl)phenyl]phenyl]propan-2-ol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 46829283 |
| Molecular Formula | C22H21F9N2O3 |
| Molecular Weight | 532.40 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[4-[4-(piperazin-1-ylmethyl)phenyl]phenyl]propan-2-ol;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.OC(c1ccc(-c2ccc(CN3CCNCC3)cc2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H20F6N2O.C2HF3O2/c21-19(22,23)18(29,20(24,25)26)17-7-5-16(6-8-17)15-3-1-14(2-4-15)13-28-11-9-27-10-12-28;3-2(4,5)1(6)7/h1-8,27,29H,9-13H2;(H,6,7) |
| InChIKey | MXSMNOCKOXLJKU-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.40 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |