C12H18F3N3O2 — CID 173118557
1-(1H-pyrrol-3-ylmethyl)-1,4-diazepane;2,2,2-trifluoroacetic acid (PubChem CID 173118557) has the molecular formula C12H18F3N3O2 and a molecular weight of 293.29 g/mol. Its IUPAC name is 1-(1H-pyrrol-3-ylmethyl)-1,4-diazepane;2,2,2-trifluoroacetic acid.
| Compound Name | 1-(1H-pyrrol-3-ylmethyl)-1,4-diazepane;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 173118557 |
| Molecular Formula | C12H18F3N3O2 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 1-(1H-pyrrol-3-ylmethyl)-1,4-diazepane;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1cc(CN2CCCNCC2)c[nH]1 |
| InChI | InChI=1S/C10H17N3.C2HF3O2/c1-3-11-5-7-13(6-1)9-10-2-4-12-8-10;3-2(4,5)1(6)7/h2,4,8,11-12H,1,3,5-7,9H2;(H,6,7) |
| InChIKey | XFFQWSSPMMQKEF-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |