C17H20F3N3O2 — CID 71771164
1-[(4-pyrrol-1-ylphenyl)methyl]piperazine;2,2,2-trifluoroacetic acid (PubChem CID 71771164) has the molecular formula C17H20F3N3O2 and a molecular weight of 355.36 g/mol. Its IUPAC name is 1-[(4-pyrrol-1-ylphenyl)methyl]piperazine;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[(4-pyrrol-1-ylphenyl)methyl]piperazine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 71771164 |
| Molecular Formula | C17H20F3N3O2 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 1-[(4-pyrrol-1-ylphenyl)methyl]piperazine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1ccn(-c2ccc(CN3CCNCC3)cc2)c1 |
| InChI | InChI=1S/C15H19N3.C2HF3O2/c1-2-10-18(9-1)15-5-3-14(4-6-15)13-17-11-7-16-8-12-17;3-2(4,5)1(6)7/h1-6,9-10,16H,7-8,11-13H2;(H,6,7) |
| InChIKey | XNWNXIALRDIBQX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |