C11H15F3N4O2 — CID 170306096
5-(piperazin-1-ylmethyl)pyrimidine;2,2,2-trifluoroacetic acid (PubChem CID 170306096) has the molecular formula C11H15F3N4O2 and a molecular weight of 292.26 g/mol. Its IUPAC name is 5-(piperazin-1-ylmethyl)pyrimidine;2,2,2-trifluoroacetic acid.
| Compound Name | 5-(piperazin-1-ylmethyl)pyrimidine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 170306096 |
| Molecular Formula | C11H15F3N4O2 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 5-(piperazin-1-ylmethyl)pyrimidine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1ncc(CN2CCNCC2)cn1 |
| InChI | InChI=1S/C9H14N4.C2HF3O2/c1-3-13(4-2-10-1)7-9-5-11-8-12-6-9;3-2(4,5)1(6)7/h5-6,8,10H,1-4,7H2;(H,6,7) |
| InChIKey | CJAGXCBTHVAEQA-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |