C15H26Cl2N4 — CID 155940752
5-[(4-piperidin-4-ylpiperidin-1-yl)methyl]pyrimidine;dihydrochloride (PubChem CID 155940752) has the molecular formula C15H26Cl2N4 and a molecular weight of 333.31 g/mol. Its IUPAC name is 5-[(4-piperidin-4-ylpiperidin-1-yl)methyl]pyrimidine;dihydrochloride.
| Compound Name | 5-[(4-piperidin-4-ylpiperidin-1-yl)methyl]pyrimidine;dihydrochloride |
|---|---|
| PubChem CID | 155940752 |
| Molecular Formula | C15H26Cl2N4 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 5-[(4-piperidin-4-ylpiperidin-1-yl)methyl]pyrimidine;dihydrochloride |
| SMILES | Cl.Cl.c1ncc(CN2CCC(C3CCNCC3)CC2)cn1 |
| InChI | InChI=1S/C15H24N4.2ClH/c1-5-16-6-2-14(1)15-3-7-19(8-4-15)11-13-9-17-12-18-10-13;;/h9-10,12,14-16H,1-8,11H2;2*1H |
| InChIKey | BJLFZYQXHWELSI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |