C24H24F9N3O4 — CID 46937204
2-amino-1-[4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]piperazin-1-yl]ethanone;2,2,2-trifluoroacetic acid (PubChem CID 46937204) has the molecular formula C24H24F9N3O4 and a molecular weight of 589.46 g/mol. Its IUPAC name is 2-amino-1-[4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]piperazin-1-yl]ethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 2-amino-1-[4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]piperazin-1-yl]ethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 46937204 |
| Molecular Formula | C24H24F9N3O4 |
| Molecular Weight | 589.46 g/mol |
| Exact Mass | 589.16 |
| IUPAC Name | 2-amino-1-[4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]piperazin-1-yl]ethanone;2,2,2-trifluoroacetic acid |
| SMILES | NCC(=O)N1CCN(Cc2ccc(-c3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)cc2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H23F6N3O2.C2HF3O2/c23-21(24,25)20(33,22(26,27)28)18-7-5-17(6-8-18)16-3-1-15(2-4-16)14-30-9-11-31(12-10-30)19(32)13-29;3-2(4,5)1(6)7/h1-8,33H,9-14,29H2;(H,6,7) |
| InChIKey | ZLFIGGCMQFEUDP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |