C19H17F6NO2 — CID 46173579
1,1,1,3,3,3-hexafluoro-2-[4-(4-morpholin-4-ylphenyl)phenyl]propan-2-ol (PubChem CID 46173579) has the molecular formula C19H17F6NO2 and a molecular weight of 405.34 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[4-(4-morpholin-4-ylphenyl)phenyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[4-(4-morpholin-4-ylphenyl)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 46173579 |
| Molecular Formula | C19H17F6NO2 |
| Molecular Weight | 405.34 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[4-(4-morpholin-4-ylphenyl)phenyl]propan-2-ol |
| SMILES | OC(c1ccc(-c2ccc(N3CCOCC3)cc2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C19H17F6NO2/c20-18(21,22)17(27,19(23,24)25)15-5-1-13(2-6-15)14-3-7-16(8-4-14)26-9-11-28-12-10-26/h1-8,27H,9-12H2 |
| InChIKey | IGTRDPWLBZZFFA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.34 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |