C8H4F10O4 — CID 87611035
2,2,3,3,4-pentafluorobutanoyl 2,2,3,3,4-pentafluorobutaneperoxoate (PubChem CID 87611035) has the molecular formula C8H4F10O4 and a molecular weight of 354.10 g/mol. Its IUPAC name is 2,2,3,3,4-pentafluorobutanoyl 2,2,3,3,4-pentafluorobutaneperoxoate.
| Compound Name | 2,2,3,3,4-pentafluorobutanoyl 2,2,3,3,4-pentafluorobutaneperoxoate |
|---|---|
| PubChem CID | 87611035 |
| Molecular Formula | C8H4F10O4 |
| Molecular Weight | 354.10 g/mol |
| Exact Mass | 353.99 |
| IUPAC Name | 2,2,3,3,4-pentafluorobutanoyl 2,2,3,3,4-pentafluorobutaneperoxoate |
| SMILES | O=C(OOC(=O)C(F)(F)C(F)(F)CF)C(F)(F)C(F)(F)CF |
| InChI | InChI=1S/C8H4F10O4/c9-1-5(11,12)7(15,16)3(19)21-22-4(20)8(17,18)6(13,14)2-10/h1-2H2 |
| InChIKey | OCLKXARHTYEYFG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.10 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|