C7H5F9O2 — CID 167596085
3-[2-(1,1-difluoroethoxy)-1,1,2,2-tetrafluoroethoxy]-2,3,3-trifluoroprop-1-ene (PubChem CID 167596085) has the molecular formula C7H5F9O2 and a molecular weight of 292.10 g/mol. Its IUPAC name is 3-[2-(1,1-difluoroethoxy)-1,1,2,2-tetrafluoroethoxy]-2,3,3-trifluoroprop-1-ene.
| Compound Name | 3-[2-(1,1-difluoroethoxy)-1,1,2,2-tetrafluoroethoxy]-2,3,3-trifluoroprop-1-ene |
|---|---|
| PubChem CID | 167596085 |
| Molecular Formula | C7H5F9O2 |
| Molecular Weight | 292.10 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 3-[2-(1,1-difluoroethoxy)-1,1,2,2-tetrafluoroethoxy]-2,3,3-trifluoroprop-1-ene |
| SMILES | C=C(F)C(F)(F)OC(F)(F)C(F)(F)OC(C)(F)F |
| InChI | InChI=1S/C7H5F9O2/c1-3(8)5(11,12)18-7(15,16)6(13,14)17-4(2,9)10/h1H2,2H3 |
| InChIKey | SOGYTPOLIPWPFJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.10 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|