C7F11NO2 — CID 175767556
2,2,3,3-tetrafluoro-3-[1,2,2,2-tetrafluoro-1-(1,2,2-trifluoroethenoxy)ethoxy]propanenitrile (PubChem CID 175767556) has the molecular formula C7F11NO2 and a molecular weight of 339.06 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-3-[1,2,2,2-tetrafluoro-1-(1,2,2-trifluoroethenoxy)ethoxy]propanenitrile.
| Compound Name | 2,2,3,3-tetrafluoro-3-[1,2,2,2-tetrafluoro-1-(1,2,2-trifluoroethenoxy)ethoxy]propanenitrile |
|---|---|
| PubChem CID | 175767556 |
| Molecular Formula | C7F11NO2 |
| Molecular Weight | 339.06 g/mol |
| Exact Mass | 338.98 |
| IUPAC Name | 2,2,3,3-tetrafluoro-3-[1,2,2,2-tetrafluoro-1-(1,2,2-trifluoroethenoxy)ethoxy]propanenitrile |
| SMILES | N#CC(F)(F)C(F)(F)OC(F)(OC(F)=C(F)F)C(F)(F)F |
| InChI | InChI=1S/C7F11NO2/c8-2(9)3(10)20-7(18,5(13,14)15)21-6(16,17)4(11,12)1-19 |
| InChIKey | ACESPMKQYYVCOY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.06 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|