C8H4F12O2 — CID 20802179
1,1,1,2,3,3-hexafluoro-3-(2,2,2-trifluoroethoxy)-2-(1,1,2-trifluoroprop-2-enoxy)propane (PubChem CID 20802179) has the molecular formula C8H4F12O2 and a molecular weight of 360.09 g/mol. Its IUPAC name is 1,1,1,2,3,3-hexafluoro-3-(2,2,2-trifluoroethoxy)-2-(1,1,2-trifluoroprop-2-enoxy)propane.
| Compound Name | 1,1,1,2,3,3-hexafluoro-3-(2,2,2-trifluoroethoxy)-2-(1,1,2-trifluoroprop-2-enoxy)propane |
|---|---|
| PubChem CID | 20802179 |
| Molecular Formula | C8H4F12O2 |
| Molecular Weight | 360.09 g/mol |
| Exact Mass | 360.00 |
| IUPAC Name | 1,1,1,2,3,3-hexafluoro-3-(2,2,2-trifluoroethoxy)-2-(1,1,2-trifluoroprop-2-enoxy)propane |
| SMILES | C=C(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OCC(F)(F)F |
| InChI | InChI=1S/C8H4F12O2/c1-3(9)5(13,14)22-6(15,7(16,17)18)8(19,20)21-2-4(10,11)12/h1-2H2 |
| InChIKey | FEMOPMROPLNCAM-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.09 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |