C9H13F5O2 — CID 20525326
1,1,2,3,3-pentafluoro-3-(2-propoxypropoxy)prop-1-ene (PubChem CID 20525326) has the molecular formula C9H13F5O2 and a molecular weight of 248.19 g/mol. Its IUPAC name is 1,1,2,3,3-pentafluoro-3-(2-propoxypropoxy)prop-1-ene.
| Compound Name | 1,1,2,3,3-pentafluoro-3-(2-propoxypropoxy)prop-1-ene |
|---|---|
| PubChem CID | 20525326 |
| Molecular Formula | C9H13F5O2 |
| Molecular Weight | 248.19 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 1,1,2,3,3-pentafluoro-3-(2-propoxypropoxy)prop-1-ene |
| SMILES | CCCOC(C)COC(F)(F)C(F)=C(F)F |
| InChI | InChI=1S/C9H13F5O2/c1-3-4-15-6(2)5-16-9(13,14)7(10)8(11)12/h6H,3-5H2,1-2H3 |
| InChIKey | VTHXLYYTGOMHES-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.19 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |