C9H8F10O2 — CID 91610180
acetyl fluoride;1,1,1,4,4,4-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)butane (PubChem CID 91610180) has the molecular formula C9H8F10O2 and a molecular weight of 338.14 g/mol. Its IUPAC name is acetyl fluoride;1,1,1,4,4,4-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)butane.
| Compound Name | acetyl fluoride;1,1,1,4,4,4-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)butane |
|---|---|
| PubChem CID | 91610180 |
| Molecular Formula | C9H8F10O2 |
| Molecular Weight | 338.14 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | acetyl fluoride;1,1,1,4,4,4-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)butane |
| SMILES | C=C(F)C(F)(F)OC(CC(F)(F)F)C(F)(F)F.CC(=O)F |
| InChI | InChI=1S/C7H5F9O.C2H3FO/c1-3(8)7(15,16)17-4(6(12,13)14)2-5(9,10)11;1-2(3)4/h4H,1-2H2;1H3 |
| InChIKey | SZIMSBRYNABTIR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.14 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|