C9H9F11O2 — CID 91520578
1,1,2,2-tetrafluoro-1-(1,1,1-trifluoropropan-2-yloxy)-3-(1,1,2-trifluoroprop-2-enoxy)propane;hydrofluoride (PubChem CID 91520578) has the molecular formula C9H9F11O2 and a molecular weight of 358.15 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-1-(1,1,1-trifluoropropan-2-yloxy)-3-(1,1,2-trifluoroprop-2-enoxy)propane;hydrofluoride.
| Compound Name | 1,1,2,2-tetrafluoro-1-(1,1,1-trifluoropropan-2-yloxy)-3-(1,1,2-trifluoroprop-2-enoxy)propane;hydrofluoride |
|---|---|
| PubChem CID | 91520578 |
| Molecular Formula | C9H9F11O2 |
| Molecular Weight | 358.15 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 1,1,2,2-tetrafluoro-1-(1,1,1-trifluoropropan-2-yloxy)-3-(1,1,2-trifluoroprop-2-enoxy)propane;hydrofluoride |
| SMILES | C=C(F)C(F)(F)OCC(F)(F)C(F)(F)OC(C)C(F)(F)F.F |
| InChI | InChI=1S/C9H8F10O2.FH/c1-4(10)8(16,17)20-3-6(11,12)9(18,19)21-5(2)7(13,14)15;/h5H,1,3H2,2H3;1H |
| InChIKey | RLISQOOJLXVUGF-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.15 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|