C19H15F23O5 — CID 54541396
2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propan-1-ol;1,1,1,2-tetrafluoro-3-methoxy-2-(1,1,2-trifluoroprop-2-enoxy)propane;3,3,3-trifluoroprop-1-ene (PubChem CID 54541396) has the molecular formula C19H15F23O5 and a molecular weight of 760.28 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propan-1-ol;1,1,1,2-tetrafluoro-3-methoxy-2-(1,1,2-trifluoroprop-2-enoxy)propane;3,3,3-trifluoroprop-1-ene.
| Compound Name | 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propan-1-ol;1,1,1,2-tetrafluoro-3-methoxy-2-(1,1,2-trifluoroprop-2-enoxy)propane;3,3,3-trifluoroprop-1-ene |
|---|---|
| PubChem CID | 54541396 |
| Molecular Formula | C19H15F23O5 |
| Molecular Weight | 760.28 g/mol |
| Exact Mass | 760.06 |
| IUPAC Name | 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propan-1-ol;1,1,1,2-tetrafluoro-3-methoxy-2-(1,1,2-trifluoroprop-2-enoxy)propane;3,3,3-trifluoroprop-1-ene |
| SMILES | C=C(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(F)(CO)C(F)(F)F.C=C(F)C(F)(F)OC(F)(COC)C(F)(F)F.C=CC(F)(F)F |
| InChI | InChI=1S/C9H5F13O3.C7H7F7O2.C3H3F3/c1-3(10)5(12,13)25-6(14,8(18,19)20)9(21,22)24-4(11,2-23)7(15,16)17;1-4(8)6(10,11)16-5(9,3-15-2)7(12,13)14;1-2-3(4,5)6/h23H,1-2H2;1,3H2,2H3;2H,1H2 |
| InChIKey | ZDLDJKZENRWRKF-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.28 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|