C12H11F13O5 — CID 91477277
3,3,3-trifluoro-2-[[2,3,3,3-tetrafluoro-2-[1,1,2-trifluoro-2-hydroxy-2-(1,1,2-trifluoroprop-2-enoxy)ethoxy]propoxy]methyl]propan-1-ol (PubChem CID 91477277) has the molecular formula C12H11F13O5 and a molecular weight of 482.19 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[[2,3,3,3-tetrafluoro-2-[1,1,2-trifluoro-2-hydroxy-2-(1,1,2-trifluoroprop-2-enoxy)ethoxy]propoxy]methyl]propan-1-ol.
| Compound Name | 3,3,3-trifluoro-2-[[2,3,3,3-tetrafluoro-2-[1,1,2-trifluoro-2-hydroxy-2-(1,1,2-trifluoroprop-2-enoxy)ethoxy]propoxy]methyl]propan-1-ol |
|---|---|
| PubChem CID | 91477277 |
| Molecular Formula | C12H11F13O5 |
| Molecular Weight | 482.19 g/mol |
| Exact Mass | 482.04 |
| IUPAC Name | 3,3,3-trifluoro-2-[[2,3,3,3-tetrafluoro-2-[1,1,2-trifluoro-2-hydroxy-2-(1,1,2-trifluoroprop-2-enoxy)ethoxy]propoxy]methyl]propan-1-ol |
| SMILES | C=C(F)C(F)(F)OC(O)(F)C(F)(F)OC(F)(COCC(CO)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H11F13O5/c1-5(13)9(18,19)30-12(25,27)11(23,24)29-7(14,10(20,21)22)4-28-3-6(2-26)8(15,16)17/h6,26-27H,1-4H2 |
| InChIKey | FWANHXRXOHXMQB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.19 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|