C5F12O2 — CID 166791480
1,1,1,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)-2-(trifluoromethoxy)ethane (PubChem CID 166791480) has the molecular formula C5F12O2 and a molecular weight of 320.03 g/mol. Its IUPAC name is 1,1,1,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)-2-(trifluoromethoxy)ethane.
| Compound Name | 1,1,1,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)-2-(trifluoromethoxy)ethane |
|---|---|
| PubChem CID | 166791480 |
| Molecular Formula | C5F12O2 |
| Molecular Weight | 320.03 g/mol |
| Exact Mass | 319.97 |
| IUPAC Name | 1,1,1,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)-2-(trifluoromethoxy)ethane |
| SMILES | FC(F)(F)OC(F)(OC(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5F12O2/c6-1(7,8)3(12,13)18-4(14,2(9,10)11)19-5(15,16)17 |
| InChIKey | KDBCXYUPZCSTDX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.03 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|