C10H6F16O6 — CID 18000075
[1,2,2,2-tetrafluoro-1-[1,1,2,2,3,3,4,4-octafluoro-4-[1,2,2,2-tetrafluoro-1-(hydroxymethoxy)ethoxy]butoxy]ethoxy]methanol (PubChem CID 18000075) has the molecular formula C10H6F16O6 and a molecular weight of 526.12 g/mol. Its IUPAC name is [1,2,2,2-tetrafluoro-1-[1,1,2,2,3,3,4,4-octafluoro-4-[1,2,2,2-tetrafluoro-1-(hydroxymethoxy)ethoxy]butoxy]ethoxy]methanol.
| Compound Name | [1,2,2,2-tetrafluoro-1-[1,1,2,2,3,3,4,4-octafluoro-4-[1,2,2,2-tetrafluoro-1-(hydroxymethoxy)ethoxy]butoxy]ethoxy]methanol |
|---|---|
| PubChem CID | 18000075 |
| Molecular Formula | C10H6F16O6 |
| Molecular Weight | 526.12 g/mol |
| Exact Mass | 525.99 |
| IUPAC Name | [1,2,2,2-tetrafluoro-1-[1,1,2,2,3,3,4,4-octafluoro-4-[1,2,2,2-tetrafluoro-1-(hydroxymethoxy)ethoxy]butoxy]ethoxy]methanol |
| SMILES | OCOC(F)(OC(F)(F)C(F)(F)C(F)(F)C(F)(F)OC(F)(OCO)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H6F16O6/c11-3(12,7(21,22)31-9(25,29-1-27)5(15,16)17)4(13,14)8(23,24)32-10(26,30-2-28)6(18,19)20/h27-28H,1-2H2 |
| InChIKey | OHIZBTLTCZRQQI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.12 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|