C5HCl2F9O — CID 175756369
1-(dichloromethoxy)-1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propane (PubChem CID 175756369) has the molecular formula C5HCl2F9O and a molecular weight of 318.95 g/mol. Its IUPAC name is 1-(dichloromethoxy)-1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propane.
| Compound Name | 1-(dichloromethoxy)-1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propane |
|---|---|
| PubChem CID | 175756369 |
| Molecular Formula | C5HCl2F9O |
| Molecular Weight | 318.95 g/mol |
| Exact Mass | 317.93 |
| IUPAC Name | 1-(dichloromethoxy)-1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propane |
| SMILES | FC(F)(F)C(F)(C(F)(F)F)C(F)(F)OC(Cl)Cl |
| InChI | InChI=1S/C5HCl2F9O/c6-1(7)17-5(15,16)2(8,3(9,10)11)4(12,13)14/h1H |
| InChIKey | DHYJWUAECKISKS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.95 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|