C8H9F9O2 — CID 151831484
1-butan-2-ylperoxy-1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propane (PubChem CID 151831484) has the molecular formula C8H9F9O2 and a molecular weight of 308.14 g/mol. Its IUPAC name is 1-butan-2-ylperoxy-1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propane.
| Compound Name | 1-butan-2-ylperoxy-1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propane |
|---|---|
| PubChem CID | 151831484 |
| Molecular Formula | C8H9F9O2 |
| Molecular Weight | 308.14 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 1-butan-2-ylperoxy-1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propane |
| SMILES | CCC(C)OOC(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H9F9O2/c1-3-4(2)18-19-8(16,17)5(9,6(10,11)12)7(13,14)15/h4H,3H2,1-2H3 |
| InChIKey | SETHDUZHUNNOMV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.14 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|