C12H12F14O4 — CID 88898107
1,1,1,2,2,3,3-heptafluoro-3-[1-[1-(1,1,2,2,3,3,3-heptafluoropropoxy)propylperoxy]propoxy]propane (PubChem CID 88898107) has the molecular formula C12H12F14O4 and a molecular weight of 486.20 g/mol. Its IUPAC name is 1,1,1,2,2,3,3-heptafluoro-3-[1-[1-(1,1,2,2,3,3,3-heptafluoropropoxy)propylperoxy]propoxy]propane.
| Compound Name | 1,1,1,2,2,3,3-heptafluoro-3-[1-[1-(1,1,2,2,3,3,3-heptafluoropropoxy)propylperoxy]propoxy]propane |
|---|---|
| PubChem CID | 88898107 |
| Molecular Formula | C12H12F14O4 |
| Molecular Weight | 486.20 g/mol |
| Exact Mass | 486.05 |
| IUPAC Name | 1,1,1,2,2,3,3-heptafluoro-3-[1-[1-(1,1,2,2,3,3,3-heptafluoropropoxy)propylperoxy]propoxy]propane |
| SMILES | CCC(OOC(CC)OC(F)(F)C(F)(F)C(F)(F)F)OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H12F14O4/c1-3-5(27-11(23,24)7(13,14)9(17,18)19)29-30-6(4-2)28-12(25,26)8(15,16)10(20,21)22/h5-6H,3-4H2,1-2H3 |
| InChIKey | CURATWULRLPWSI-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.20 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|