C20H42O5 — CID 87588712
2-[1-butan-2-yloxy-1-[1,1-di(butan-2-yloxy)ethoxy]ethoxy]butane (PubChem CID 87588712) has the molecular formula C20H42O5 and a molecular weight of 362.55 g/mol. Its IUPAC name is 2-[1-butan-2-yloxy-1-[1,1-di(butan-2-yloxy)ethoxy]ethoxy]butane.
| Compound Name | 2-[1-butan-2-yloxy-1-[1,1-di(butan-2-yloxy)ethoxy]ethoxy]butane |
|---|---|
| PubChem CID | 87588712 |
| Molecular Formula | C20H42O5 |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.30 |
| IUPAC Name | 2-[1-butan-2-yloxy-1-[1,1-di(butan-2-yloxy)ethoxy]ethoxy]butane |
| SMILES | CCC(C)OC(C)(OC(C)CC)OC(C)(OC(C)CC)OC(C)CC |
| InChI | InChI=1S/C20H42O5/c1-11-15(5)21-19(9,22-16(6)12-2)25-20(10,23-17(7)13-3)24-18(8)14-4/h15-18H,11-14H2,1-10H3 |
| InChIKey | YMGIXEANXGXWHI-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|