C12H8F18O — CID 141059311
1,1,1,2,3,3-hexafluoro-4-[3,3,4,5,5,5-hexafluoro-4-(trifluoromethyl)pentan-2-yl]oxy-2-(trifluoromethyl)pentane (PubChem CID 141059311) has the molecular formula C12H8F18O and a molecular weight of 510.16 g/mol. Its IUPAC name is 1,1,1,2,3,3-hexafluoro-4-[3,3,4,5,5,5-hexafluoro-4-(trifluoromethyl)pentan-2-yl]oxy-2-(trifluoromethyl)pentane.
| Compound Name | 1,1,1,2,3,3-hexafluoro-4-[3,3,4,5,5,5-hexafluoro-4-(trifluoromethyl)pentan-2-yl]oxy-2-(trifluoromethyl)pentane |
|---|---|
| PubChem CID | 141059311 |
| Molecular Formula | C12H8F18O |
| Molecular Weight | 510.16 g/mol |
| Exact Mass | 510.03 |
| IUPAC Name | 1,1,1,2,3,3-hexafluoro-4-[3,3,4,5,5,5-hexafluoro-4-(trifluoromethyl)pentan-2-yl]oxy-2-(trifluoromethyl)pentane |
| SMILES | CC(OC(C)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H8F18O/c1-3(5(13,14)7(17,9(19,20)21)10(22,23)24)31-4(2)6(15,16)8(18,11(25,26)27)12(28,29)30/h3-4H,1-2H3 |
| InChIKey | KLALGQGHHUUFGF-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.16 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |