C12H26O2 — CID 134572813
2,2-dimethyl-3-[1-[(2-methylpropan-2-yl)oxy]ethoxy]butane (PubChem CID 134572813) has the molecular formula C12H26O2 and a molecular weight of 202.34 g/mol. Its IUPAC name is 2,2-dimethyl-3-[1-[(2-methylpropan-2-yl)oxy]ethoxy]butane.
| Compound Name | 2,2-dimethyl-3-[1-[(2-methylpropan-2-yl)oxy]ethoxy]butane |
|---|---|
| PubChem CID | 134572813 |
| Molecular Formula | C12H26O2 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.19 |
| IUPAC Name | 2,2-dimethyl-3-[1-[(2-methylpropan-2-yl)oxy]ethoxy]butane |
| SMILES | CC(OC(C)C(C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C12H26O2/c1-9(11(3,4)5)13-10(2)14-12(6,7)8/h9-10H,1-8H3 |
| InChIKey | CFRPEYQGQRHYQL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|