C13H25F3O2 — CID 121371563
3-[2,2-dimethyl-1-(2,2,2-trifluoroethoxy)propoxy]-2,2-dimethylbutane (PubChem CID 121371563) has the molecular formula C13H25F3O2 and a molecular weight of 270.34 g/mol. Its IUPAC name is 3-[2,2-dimethyl-1-(2,2,2-trifluoroethoxy)propoxy]-2,2-dimethylbutane.
| Compound Name | 3-[2,2-dimethyl-1-(2,2,2-trifluoroethoxy)propoxy]-2,2-dimethylbutane |
|---|---|
| PubChem CID | 121371563 |
| Molecular Formula | C13H25F3O2 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 3-[2,2-dimethyl-1-(2,2,2-trifluoroethoxy)propoxy]-2,2-dimethylbutane |
| SMILES | CC(OC(OCC(F)(F)F)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H25F3O2/c1-9(11(2,3)4)18-10(12(5,6)7)17-8-13(14,15)16/h9-10H,8H2,1-7H3 |
| InChIKey | QRSBSLULQMRNBT-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|