C6H10F3LiO2 — CID 175980012
lithium 3-(2,2,2-trifluoroethoxy)butan-1-olate (PubChem CID 175980012) has the molecular formula C6H10F3LiO2 and a molecular weight of 178.08 g/mol. Its IUPAC name is lithium 3-(2,2,2-trifluoroethoxy)butan-1-olate.
| Compound Name | lithium 3-(2,2,2-trifluoroethoxy)butan-1-olate |
|---|---|
| PubChem CID | 175980012 |
| Molecular Formula | C6H10F3LiO2 |
| Molecular Weight | 178.08 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | lithium 3-(2,2,2-trifluoroethoxy)butan-1-olate |
| SMILES | CC(CC[O-])OCC(F)(F)F.[Li+] |
| InChI | InChI=1S/C6H10F3O2.Li/c1-5(2-3-10)11-4-6(7,8)9;/h5H,2-4H2,1H3;/q-1;+1 |
| InChIKey | YHHRZVCUGUQKNN-UHFFFAOYSA-N |
| XLogP | -2.29 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.08 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |