C8H7F10LiO2 — CID 175979984
lithium 2-(1,1,1,2,2,4,4,5,5,5-decafluoropentan-3-yloxy)propan-1-olate (PubChem CID 175979984) has the molecular formula C8H7F10LiO2 and a molecular weight of 332.06 g/mol. Its IUPAC name is lithium 2-(1,1,1,2,2,4,4,5,5,5-decafluoropentan-3-yloxy)propan-1-olate.
| Compound Name | lithium 2-(1,1,1,2,2,4,4,5,5,5-decafluoropentan-3-yloxy)propan-1-olate |
|---|---|
| PubChem CID | 175979984 |
| Molecular Formula | C8H7F10LiO2 |
| Molecular Weight | 332.06 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | lithium 2-(1,1,1,2,2,4,4,5,5,5-decafluoropentan-3-yloxy)propan-1-olate |
| SMILES | CC(C[O-])OC(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F.[Li+] |
| InChI | InChI=1S/C8H7F10O2.Li/c1-3(2-19)20-4(5(9,10)7(13,14)15)6(11,12)8(16,17)18;/h3-4H,2H2,1H3;/q-1;+1 |
| InChIKey | QSSBMQOOPSDNLQ-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.06 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|