C9H14F6O2 — CID 19828970
2-methyl-1,1-bis(2,2,2-trifluoroethoxy)butane (PubChem CID 19828970) has the molecular formula C9H14F6O2 and a molecular weight of 268.20 g/mol. Its IUPAC name is 2-methyl-1,1-bis(2,2,2-trifluoroethoxy)butane.
| Compound Name | 2-methyl-1,1-bis(2,2,2-trifluoroethoxy)butane |
|---|---|
| PubChem CID | 19828970 |
| Molecular Formula | C9H14F6O2 |
| Molecular Weight | 268.20 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 2-methyl-1,1-bis(2,2,2-trifluoroethoxy)butane |
| SMILES | CCC(C)C(OCC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C9H14F6O2/c1-3-6(2)7(16-4-8(10,11)12)17-5-9(13,14)15/h6-7H,3-5H2,1-2H3 |
| InChIKey | WORQGBWSIBXOJT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.20 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|