C8H11F7O4 — CID 89251354
1-[1,2-dimethoxy-2-(2,2,2-trifluoroethoxy)ethoxy]-1,1,2,2-tetrafluoroethane (PubChem CID 89251354) has the molecular formula C8H11F7O4 and a molecular weight of 304.16 g/mol. Its IUPAC name is 1-[1,2-dimethoxy-2-(2,2,2-trifluoroethoxy)ethoxy]-1,1,2,2-tetrafluoroethane.
| Compound Name | 1-[1,2-dimethoxy-2-(2,2,2-trifluoroethoxy)ethoxy]-1,1,2,2-tetrafluoroethane |
|---|---|
| PubChem CID | 89251354 |
| Molecular Formula | C8H11F7O4 |
| Molecular Weight | 304.16 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 1-[1,2-dimethoxy-2-(2,2,2-trifluoroethoxy)ethoxy]-1,1,2,2-tetrafluoroethane |
| SMILES | COC(OCC(F)(F)F)C(OC)OC(F)(F)C(F)F |
| InChI | InChI=1S/C8H11F7O4/c1-16-4(18-3-7(11,12)13)5(17-2)19-8(14,15)6(9)10/h4-6H,3H2,1-2H3 |
| InChIKey | NMFFKJSVSSHWRX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.16 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|