C8H14F3NO2 — CID 15170730
2,2,2-trifluoroethyl (2S,3S)-2-amino-3-methylpentanoate (PubChem CID 15170730) has the molecular formula C8H14F3NO2 and a molecular weight of 213.20 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl (2S,3S)-2-amino-3-methylpentanoate.
| Compound Name | 2,2,2-trifluoroethyl (2S,3S)-2-amino-3-methylpentanoate |
|---|---|
| PubChem CID | 15170730 |
| Molecular Formula | C8H14F3NO2 |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 2,2,2-trifluoroethyl (2S,3S)-2-amino-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@H](N)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C8H14F3NO2/c1-3-5(2)6(12)7(13)14-4-8(9,10)11/h5-6H,3-4,12H2,1-2H3/t5-,6-/m0/s1 |
| InChIKey | WQYMRQNWNSMNAV-WDSKDSINSA-N |
| XLogP | 1.47 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |