C8H14F3NO2 — CID 15170731
2,2,2-trifluoroethyl (2S)-2-amino-3,3-dimethylbutanoate (PubChem CID 15170731) has the molecular formula C8H14F3NO2 and a molecular weight of 213.20 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl (2S)-2-amino-3,3-dimethylbutanoate.
| Compound Name | 2,2,2-trifluoroethyl (2S)-2-amino-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 15170731 |
| Molecular Formula | C8H14F3NO2 |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 2,2,2-trifluoroethyl (2S)-2-amino-3,3-dimethylbutanoate |
| SMILES | CC(C)(C)[C@H](N)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C8H14F3NO2/c1-7(2,3)5(12)6(13)14-4-8(9,10)11/h5H,4,12H2,1-3H3/t5-/m1/s1 |
| InChIKey | MQEXKWWMTUTKDK-RXMQYKEDSA-N |
| XLogP | 1.47 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |