C10H12F6O10S2 — CID 88550832
bis(2,2,2-trifluoroethyl) 2,3-bis(methylsulfonyloxy)butanedioate (PubChem CID 88550832) has the molecular formula C10H12F6O10S2 and a molecular weight of 470.32 g/mol. Its IUPAC name is bis(2,2,2-trifluoroethyl) 2,3-bis(methylsulfonyloxy)butanedioate.
| Compound Name | bis(2,2,2-trifluoroethyl) 2,3-bis(methylsulfonyloxy)butanedioate |
|---|---|
| PubChem CID | 88550832 |
| Molecular Formula | C10H12F6O10S2 |
| Molecular Weight | 470.32 g/mol |
| Exact Mass | 469.98 |
| IUPAC Name | bis(2,2,2-trifluoroethyl) 2,3-bis(methylsulfonyloxy)butanedioate |
| SMILES | CS(=O)(=O)OC(C(=O)OCC(F)(F)F)C(OS(C)(=O)=O)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C10H12F6O10S2/c1-27(19,20)25-5(7(17)23-3-9(11,12)13)6(26-28(2,21)22)8(18)24-4-10(14,15)16/h5-6H,3-4H2,1-2H3 |
| InChIKey | QTHOHXBTWHLNEI-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.32 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|