C15H32O4 — CID 121371559
3-[1-[2-(methoxymethoxy)ethoxy]-2,2-dimethylpropoxy]-2,2-dimethylbutane (PubChem CID 121371559) has the molecular formula C15H32O4 and a molecular weight of 276.42 g/mol. Its IUPAC name is 3-[1-[2-(methoxymethoxy)ethoxy]-2,2-dimethylpropoxy]-2,2-dimethylbutane.
| Compound Name | 3-[1-[2-(methoxymethoxy)ethoxy]-2,2-dimethylpropoxy]-2,2-dimethylbutane |
|---|---|
| PubChem CID | 121371559 |
| Molecular Formula | C15H32O4 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | 3-[1-[2-(methoxymethoxy)ethoxy]-2,2-dimethylpropoxy]-2,2-dimethylbutane |
| SMILES | COCOCCOC(OC(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H32O4/c1-12(14(2,3)4)19-13(15(5,6)7)18-10-9-17-11-16-8/h12-13H,9-11H2,1-8H3 |
| InChIKey | ACHVSJSVYRELGU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|