About 3-[1-[2-(methoxymethoxy)ethoxy]-2,2-dimethylpropoxy]-2,2-dimethylbutane
3-[1-[2-(methoxymethoxy)ethoxy]-2,2-dimethylpropoxy]-2,2-dimethylbutane (PubChem CID 121371559) has the molecular formula C15H32O4
and a molecular weight of 276.42 g/mol. Its IUPAC name is 3-[1-[2-(methoxymethoxy)ethoxy]-2,2-dimethylpropoxy]-2,2-dimethylbutane.
Molecular Properties
| Compound Name | 3-[1-[2-(methoxymethoxy)ethoxy]-2,2-dimethylpropoxy]-2,2-dimethylbutane |
| PubChem CID | 121371559 |
| Molecular Formula | C15H32O4 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | 3-[1-[2-(methoxymethoxy)ethoxy]-2,2-dimethylpropoxy]-2,2-dimethylbutane |
| SMILES | COCOCCOC(OC(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H32O4/c1-12(14(2,3)4)19-13(15(5,6)7)18-10-9-17-11-16-8/h12-13H,9-11H2,1-8H3 |
| InChIKey | ACHVSJSVYRELGU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-[1-[2-(methoxymethoxy)ethoxy]-2,2-dimethylpropoxy]-2,2-dimethylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-[2-(methoxymethoxy)ethoxy]-2,2-dimethylpropoxy]-2,2-dimethylbutane?
The IUPAC name of 3-[1-[2-(methoxymethoxy)ethoxy]-2,2-dimethylpropoxy]-2,2-dimethylbutane (CID 121371559) is 3-[1-[2-(methoxymethoxy)ethoxy]-2,2-dimethylpropoxy]-2,2-dimethylbutane.
What is the SMILES notation for 3-[1-[2-(methoxymethoxy)ethoxy]-2,2-dimethylpropoxy]-2,2-dimethylbutane?
The canonical SMILES for 3-[1-[2-(methoxymethoxy)ethoxy]-2,2-dimethylpropoxy]-2,2-dimethylbutane is COCOCCOC(OC(C)C(C)(C)C)C(C)(C)C.
What is the InChIKey of 3-[1-[2-(methoxymethoxy)ethoxy]-2,2-dimethylpropoxy]-2,2-dimethylbutane?
The InChIKey is ACHVSJSVYRELGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32O4/c1-12(14(2,3)4)19-13(15(5,6)7)18-10-9-17-11-16-8/h12-13H,9-11H2,1-8H3.
What are the key properties of 3-[1-[2-(methoxymethoxy)ethoxy]-2,2-dimethylpropoxy]-2,2-dimethylbutane?
3-[1-[2-(methoxymethoxy)ethoxy]-2,2-dimethylpropoxy]-2,2-dimethylbutane has a molecular weight of 276.42 g/mol, XLogP of 3.45, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-[2-(methoxymethoxy)ethoxy]-2,2-dimethylpropoxy]-2,2-dimethylbutane is sourced from PubChem (CID 121371559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).