About lithium;hydride;1-[(2-methylpropan-2-yl)oxy]ethoxyalumane
lithium;hydride;1-[(2-methylpropan-2-yl)oxy]ethoxyalumane (PubChem CID 175098848) has the molecular formula C6H16AlLiO2
and a molecular weight of 154.12 g/mol. Its IUPAC name is lithium;hydride;1-[(2-methylpropan-2-yl)oxy]ethoxyalumane.
Molecular Properties
| Compound Name | lithium;hydride;1-[(2-methylpropan-2-yl)oxy]ethoxyalumane |
| PubChem CID | 175098848 |
| Molecular Formula | C6H16AlLiO2 |
| Molecular Weight | 154.12 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | lithium;hydride;1-[(2-methylpropan-2-yl)oxy]ethoxyalumane |
| SMILES | CC(O[AlH2])OC(C)(C)C.[H-].[Li+] |
| InChI | InChI=1S/C6H13O2.Al.Li.3H/c1-5(7)8-6(2,3)4;;;;;/h5H,1-4H3;;;;;/q-1;2*+1;;;-1 |
| InChIKey | JBULIVULEMDQTQ-UHFFFAOYSA-N |
| XLogP | -2.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.12 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze lithium;hydride;1-[(2-methylpropan-2-yl)oxy]ethoxyalumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;hydride;1-[(2-methylpropan-2-yl)oxy]ethoxyalumane?
The IUPAC name of lithium;hydride;1-[(2-methylpropan-2-yl)oxy]ethoxyalumane (CID 175098848) is lithium;hydride;1-[(2-methylpropan-2-yl)oxy]ethoxyalumane.
What is the SMILES notation for lithium;hydride;1-[(2-methylpropan-2-yl)oxy]ethoxyalumane?
The canonical SMILES for lithium;hydride;1-[(2-methylpropan-2-yl)oxy]ethoxyalumane is CC(O[AlH2])OC(C)(C)C.[H-].[Li+].
What is the InChIKey of lithium;hydride;1-[(2-methylpropan-2-yl)oxy]ethoxyalumane?
The InChIKey is JBULIVULEMDQTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13O2.Al.Li.3H/c1-5(7)8-6(2,3)4;;;;;/h5H,1-4H3;;;;;/q-1;2*+1;;;-1.
What are the key properties of lithium;hydride;1-[(2-methylpropan-2-yl)oxy]ethoxyalumane?
lithium;hydride;1-[(2-methylpropan-2-yl)oxy]ethoxyalumane has a molecular weight of 154.12 g/mol, XLogP of -2.17, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hydride;1-[(2-methylpropan-2-yl)oxy]ethoxyalumane is sourced from PubChem (CID 175098848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).