C5H2BrF9O — CID 175695876
1-(bromomethoxy)-1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propane (PubChem CID 175695876) has the molecular formula C5H2BrF9O and a molecular weight of 328.96 g/mol. Its IUPAC name is 1-(bromomethoxy)-1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propane.
| Compound Name | 1-(bromomethoxy)-1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propane |
|---|---|
| PubChem CID | 175695876 |
| Molecular Formula | C5H2BrF9O |
| Molecular Weight | 328.96 g/mol |
| Exact Mass | 327.91 |
| IUPAC Name | 1-(bromomethoxy)-1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propane |
| SMILES | FC(F)(F)C(F)(C(F)(F)F)C(F)(F)OCBr |
| InChI | InChI=1S/C5H2BrF9O/c6-1-16-5(14,15)2(7,3(8,9)10)4(11,12)13/h1H2 |
| InChIKey | BJGSWFUZOBOOGG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.96 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|