C5H4F7IO — CID 170556920
1,1,2,2-tetrafluoro-3-iodo-1-(1,2,2-trifluoroethoxy)propane (PubChem CID 170556920) has the molecular formula C5H4F7IO and a molecular weight of 339.98 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-3-iodo-1-(1,2,2-trifluoroethoxy)propane.
| Compound Name | 1,1,2,2-tetrafluoro-3-iodo-1-(1,2,2-trifluoroethoxy)propane |
|---|---|
| PubChem CID | 170556920 |
| Molecular Formula | C5H4F7IO |
| Molecular Weight | 339.98 g/mol |
| Exact Mass | 339.92 |
| IUPAC Name | 1,1,2,2-tetrafluoro-3-iodo-1-(1,2,2-trifluoroethoxy)propane |
| SMILES | FC(F)C(F)OC(F)(F)C(F)(F)CI |
| InChI | InChI=1S/C5H4F7IO/c6-2(7)3(8)14-5(11,12)4(9,10)1-13/h2-3H,1H2 |
| InChIKey | CVIUBRONWJATLP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.98 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|