C2BF5O3-2 — CID 154095446
dioxido(1,1,2,2,2-pentafluoroethoxy)borane (PubChem CID 154095446) has the molecular formula C2BF5O3-2 and a molecular weight of 177.82 g/mol. Its IUPAC name is dioxido(1,1,2,2,2-pentafluoroethoxy)borane.
| Compound Name | dioxido(1,1,2,2,2-pentafluoroethoxy)borane |
|---|---|
| PubChem CID | 154095446 |
| Molecular Formula | C2BF5O3-2 |
| Molecular Weight | 177.82 g/mol |
| Exact Mass | 177.99 |
| IUPAC Name | dioxido(1,1,2,2,2-pentafluoroethoxy)borane |
| SMILES | [O-]B([O-])OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C2BF5O3/c4-1(5,6)2(7,8)11-3(9)10/q-2 |
| InChIKey | IEYMQLAMIAOPFK-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 55.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.82 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|