C2F5KO3P+ — CID 172796390
potassium oxido-oxo-(1,1,2,2,2-pentafluoroethoxy)phosphanium (PubChem CID 172796390) has the molecular formula C2F5KO3P+ and a molecular weight of 237.08 g/mol. Its IUPAC name is potassium oxido-oxo-(1,1,2,2,2-pentafluoroethoxy)phosphanium.
| Compound Name | potassium oxido-oxo-(1,1,2,2,2-pentafluoroethoxy)phosphanium |
|---|---|
| PubChem CID | 172796390 |
| Molecular Formula | C2F5KO3P+ |
| Molecular Weight | 237.08 g/mol |
| Exact Mass | 236.91 |
| IUPAC Name | potassium oxido-oxo-(1,1,2,2,2-pentafluoroethoxy)phosphanium |
| SMILES | O=[P+]([O-])OC(F)(F)C(F)(F)F.[K+] |
| InChI | InChI=1S/C2F5O3P.K/c3-1(4,5)2(6,7)10-11(8)9;/q;+1 |
| InChIKey | RHSDJMPYZMWJLL-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.08 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|