C8H4F11IO2 — CID 151348813
4,5,5,6,6,7,7,7-octafluoro-2-iodo-3-(trifluoromethyl)heptanoic acid (PubChem CID 151348813) has the molecular formula C8H4F11IO2 and a molecular weight of 468.00 g/mol. Its IUPAC name is 4,5,5,6,6,7,7,7-octafluoro-2-iodo-3-(trifluoromethyl)heptanoic acid.
| Compound Name | 4,5,5,6,6,7,7,7-octafluoro-2-iodo-3-(trifluoromethyl)heptanoic acid |
|---|---|
| PubChem CID | 151348813 |
| Molecular Formula | C8H4F11IO2 |
| Molecular Weight | 468.00 g/mol |
| Exact Mass | 467.91 |
| IUPAC Name | 4,5,5,6,6,7,7,7-octafluoro-2-iodo-3-(trifluoromethyl)heptanoic acid |
| SMILES | O=C(O)C(I)C(C(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H4F11IO2/c9-3(1(6(12,13)14)2(20)4(21)22)5(10,11)7(15,16)8(17,18)19/h1-3H,(H,21,22) |
| InChIKey | OMAZIAKTCPEECC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.00 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|